C25H36ClN3O2 — CID 68677129
[(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-(4-ethyl-3,5-dimethylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 68677129) has the molecular formula C25H36ClN3O2 and a molecular weight of 446.04 g/mol. Its IUPAC name is [(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-(4-ethyl-3,5-dimethylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-(4-ethyl-3,5-dimethylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 68677129 |
| Molecular Formula | C25H36ClN3O2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-(4-ethyl-3,5-dimethylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CCN1C(C)CN(C(=O)c2cn3c4c(cccc24)OC[C@H]3C2CCCCC2)CC1C.Cl |
| InChI | InChI=1S/C25H35N3O2.ClH/c1-4-27-17(2)13-26(14-18(27)3)25(29)21-15-28-22(19-9-6-5-7-10-19)16-30-23-12-8-11-20(21)24(23)28;/h8,11-12,15,17-19,22H,4-7,9-10,13-14,16H2,1-3H3;1H/t17?,18?,22-;/m0./s1 |
| InChIKey | ICJNFQHCAOQUSD-OUZLULMCSA-N |
| XLogP | 5.13 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |