C21H19FN2O4 — CID 68678315
N-[[3-[(E)-(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]methyl]acetamide (PubChem CID 68678315) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is N-[[3-[(E)-(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[(E)-(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 68678315 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-[[3-[(E)-(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]methyl]acetamide |
| SMILES | CO/C(=C1/C(=O)N(C(C)=O)c2cc(F)ccc21)c1cccc(CNC(C)=O)c1 |
| InChI | InChI=1S/C21H19FN2O4/c1-12(25)23-11-14-5-4-6-15(9-14)20(28-3)19-17-8-7-16(22)10-18(17)24(13(2)26)21(19)27/h4-10H,11H2,1-3H3,(H,23,25)/b20-19+ |
| InChIKey | IZRSCYGLWHARLD-FMQUCBEESA-N |
| XLogP | 2.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|