About methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate
methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate (PubChem CID 68680510) has the molecular formula C16H15ClF2N2O3
and a molecular weight of 356.76 g/mol. Its IUPAC name is methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate |
| PubChem CID | 68680510 |
| Molecular Formula | C16H15ClF2N2O3 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2[nH]c(C(=O)N3CCC(F)(F)CC3)cc2c1 |
| InChI | InChI=1S/C16H15ClF2N2O3/c1-24-15(23)10-6-9-8-12(20-13(9)11(17)7-10)14(22)21-4-2-16(18,19)3-5-21/h6-8,20H,2-5H2,1H3 |
| InChIKey | HAFSXONYRAPJID-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate?
The IUPAC name of methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate (CID 68680510) is methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate.
What is the SMILES notation for methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate?
The canonical SMILES for methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate is COC(=O)c1cc(Cl)c2[nH]c(C(=O)N3CCC(F)(F)CC3)cc2c1.
What is the InChIKey of methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate?
The InChIKey is HAFSXONYRAPJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClF2N2O3/c1-24-15(23)10-6-9-8-12(20-13(9)11(17)7-10)14(22)21-4-2-16(18,19)3-5-21/h6-8,20H,2-5H2,1H3.
What are the key properties of methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate?
methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate has a molecular weight of 356.76 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-chloro-2-(4,4-difluoropiperidine-1-carbonyl)-1H-indole-5-carboxylate is sourced from PubChem (CID 68680510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).