C24H33ClF2N4O2 — CID 16727158
[6-chloro-5-[3-(1-propan-2-ylpiperidin-4-yl)propoxy]-1H-pyrrolo[2,3-b]pyridin-2-yl]-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 16727158) has the molecular formula C24H33ClF2N4O2 and a molecular weight of 483.00 g/mol. Its IUPAC name is [6-chloro-5-[3-(1-propan-2-ylpiperidin-4-yl)propoxy]-1H-pyrrolo[2,3-b]pyridin-2-yl]-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | [6-chloro-5-[3-(1-propan-2-ylpiperidin-4-yl)propoxy]-1H-pyrrolo[2,3-b]pyridin-2-yl]-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 16727158 |
| Molecular Formula | C24H33ClF2N4O2 |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [6-chloro-5-[3-(1-propan-2-ylpiperidin-4-yl)propoxy]-1H-pyrrolo[2,3-b]pyridin-2-yl]-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | CC(C)N1CCC(CCCOc2cc3cc(C(=O)N4CCC(F)(F)CC4)[nH]c3nc2Cl)CC1 |
| InChI | InChI=1S/C24H33ClF2N4O2/c1-16(2)30-9-5-17(6-10-30)4-3-13-33-20-15-18-14-19(28-22(18)29-21(20)25)23(32)31-11-7-24(26,27)8-12-31/h14-17H,3-13H2,1-2H3,(H,28,29) |
| InChIKey | XNLMKAFAYNFHGH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|