C15H17NO5 — CID 68682862
2-[(2-hydroxy-2,3,4,4a,5,6-hexahydro-1H-phenanthridin-10b-yl)oxy]-2-oxoacetic acid (PubChem CID 68682862) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-[(2-hydroxy-2,3,4,4a,5,6-hexahydro-1H-phenanthridin-10b-yl)oxy]-2-oxoacetic acid.
| Compound Name | 2-[(2-hydroxy-2,3,4,4a,5,6-hexahydro-1H-phenanthridin-10b-yl)oxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 68682862 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(2-hydroxy-2,3,4,4a,5,6-hexahydro-1H-phenanthridin-10b-yl)oxy]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)OC12CC(O)CCC1NCc1ccccc12 |
| InChI | InChI=1S/C15H17NO5/c17-10-5-6-12-15(7-10,21-14(20)13(18)19)11-4-2-1-3-9(11)8-16-12/h1-4,10,12,16-17H,5-8H2,(H,18,19) |
| InChIKey | JKXIZMBNSBEPBI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|