C22H25ClN4O5S — CID 68683199
(5R)-5-[2-[3-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]phenyl]ethyl]imidazolidine-2,4-dione (PubChem CID 68683199) has the molecular formula C22H25ClN4O5S and a molecular weight of 492.99 g/mol. Its IUPAC name is (5R)-5-[2-[3-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]phenyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[3-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]phenyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 68683199 |
| Molecular Formula | C22H25ClN4O5S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | (5R)-5-[2-[3-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]phenyl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H](CCc2cccc(CS(=O)(=O)N3CCC(Oc4ccc(Cl)cn4)CC3)c2)N1 |
| InChI | InChI=1S/C22H25ClN4O5S/c23-17-5-7-20(24-13-17)32-18-8-10-27(11-9-18)33(30,31)14-16-3-1-2-15(12-16)4-6-19-21(28)26-22(29)25-19/h1-3,5,7,12-13,18-19H,4,6,8-11,14H2,(H2,25,26,28,29)/t19-/m1/s1 |
| InChIKey | BMOPTXYHKNWMNA-LJQANCHMSA-N |
| XLogP | 2.25 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|