C25H21NO4S — CID 68689484
3-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethyl]benzoic acid (PubChem CID 68689484) has the molecular formula C25H21NO4S and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethyl]benzoic acid.
| Compound Name | 3-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68689484 |
| Molecular Formula | C25H21NO4S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCc2ccccc2NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C25H21NO4S/c27-25(28)22-10-5-6-18(16-22)12-13-20-8-3-4-11-24(20)26-31(29,30)23-15-14-19-7-1-2-9-21(19)17-23/h1-11,14-17,26H,12-13H2,(H,27,28) |
| InChIKey | PQKXSRIGMFYJTR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |