C18H23N5 — CID 68696826
2-[2-(cyclohexylamino)-5-methylpyrimidin-4-yl]acetonitrile;pyridine (PubChem CID 68696826) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-[2-(cyclohexylamino)-5-methylpyrimidin-4-yl]acetonitrile;pyridine.
| Compound Name | 2-[2-(cyclohexylamino)-5-methylpyrimidin-4-yl]acetonitrile;pyridine |
|---|---|
| PubChem CID | 68696826 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 2-[2-(cyclohexylamino)-5-methylpyrimidin-4-yl]acetonitrile;pyridine |
| SMILES | Cc1cnc(NC2CCCCC2)nc1CC#N.c1ccncc1 |
| InChI | InChI=1S/C13H18N4.C5H5N/c1-10-9-15-13(17-12(10)7-8-14)16-11-5-3-2-4-6-11;1-2-4-6-5-3-1/h9,11H,2-7H2,1H3,(H,15,16,17);1-5H |
| InChIKey | GLEBAFHQVSQKIP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |