C34H46N2O3 — CID 68696992
N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hept-6-enamide (PubChem CID 68696992) has the molecular formula C34H46N2O3 and a molecular weight of 530.75 g/mol. Its IUPAC name is N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hept-6-enamide.
| Compound Name | N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hept-6-enamide |
|---|---|
| PubChem CID | 68696992 |
| Molecular Formula | C34H46N2O3 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hept-6-enamide |
| SMILES | C=CCCCCC(=O)N[C@@H](Cc1cccc(CC=C)c1)[C@@H](O)CN[C@H]1CC2(CCC2)Oc2ccc(CC)cc21 |
| InChI | InChI=1S/C34H46N2O3/c1-4-7-8-9-15-33(38)36-29(22-27-14-10-13-26(20-27)12-5-2)31(37)24-35-30-23-34(18-11-19-34)39-32-17-16-25(6-3)21-28(30)32/h4-5,10,13-14,16-17,20-21,29-31,35,37H,1-2,6-9,11-12,15,18-19,22-24H2,3H3,(H,36,38)/t29-,30-,31-/m0/s1 |
| InChIKey | KNUQXNGMAGESQG-CHQNGUEUSA-N |
| XLogP | 6.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|