C21H22BrN3O — CID 68698610
(4E)-8-bromo-4-[[4-(pyrrolidin-1-ylmethyl)anilino]methylidene]-1,2-dihydroisoquinolin-3-one (PubChem CID 68698610) has the molecular formula C21H22BrN3O and a molecular weight of 412.33 g/mol. Its IUPAC name is (4E)-8-bromo-4-[[4-(pyrrolidin-1-ylmethyl)anilino]methylidene]-1,2-dihydroisoquinolin-3-one.
| Compound Name | (4E)-8-bromo-4-[[4-(pyrrolidin-1-ylmethyl)anilino]methylidene]-1,2-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 68698610 |
| Molecular Formula | C21H22BrN3O |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (4E)-8-bromo-4-[[4-(pyrrolidin-1-ylmethyl)anilino]methylidene]-1,2-dihydroisoquinolin-3-one |
| SMILES | O=C1NCc2c(Br)cccc2/C1=C\Nc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C21H22BrN3O/c22-20-5-3-4-17-18(20)12-24-21(26)19(17)13-23-16-8-6-15(7-9-16)14-25-10-1-2-11-25/h3-9,13,23H,1-2,10-12,14H2,(H,24,26)/b19-13+ |
| InChIKey | KVSUKOHESAAZRF-CPNJWEJPSA-N |
| XLogP | 4.13 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|