C22H20N4O6 — CID 68699461
[[3-(2,4-dimethoxyphenyl)-1-methyl-2-oxo-9H-pyrido[2,3-b]indole-6-carbonyl]amino]carbamic acid (PubChem CID 68699461) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is [[3-(2,4-dimethoxyphenyl)-1-methyl-2-oxo-9H-pyrido[2,3-b]indole-6-carbonyl]amino]carbamic acid.
| Compound Name | [[3-(2,4-dimethoxyphenyl)-1-methyl-2-oxo-9H-pyrido[2,3-b]indole-6-carbonyl]amino]carbamic acid |
|---|---|
| PubChem CID | 68699461 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [[3-(2,4-dimethoxyphenyl)-1-methyl-2-oxo-9H-pyrido[2,3-b]indole-6-carbonyl]amino]carbamic acid |
| SMILES | COc1ccc(-c2cc3c4cc(C(=O)NNC(=O)O)ccc4[nH]c3n(C)c2=O)c(OC)c1 |
| InChI | InChI=1S/C22H20N4O6/c1-26-19-15(10-16(21(26)28)13-6-5-12(31-2)9-18(13)32-3)14-8-11(4-7-17(14)23-19)20(27)24-25-22(29)30/h4-10,23,25H,1-3H3,(H,24,27)(H,29,30) |
| InChIKey | AKKVDVDPIFQMGE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|