C27H31N5O2 — CID 68706151
5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxan-2-yl)-N-[3-[3-(dimethylamino)prop-1-enyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 68706151) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxan-2-yl)-N-[3-[3-(dimethylamino)prop-1-enyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxan-2-yl)-N-[3-[3-(dimethylamino)prop-1-enyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 68706151 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 5-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxan-2-yl)-N-[3-[3-(dimethylamino)prop-1-enyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CN(C)CC=Cc1cccc(Nc2nc3cccc(C4COCC(C5=CC=CCC5)O4)n3n2)c1 |
| InChI | InChI=1S/C27H31N5O2/c1-31(2)16-8-10-20-9-6-13-22(17-20)28-27-29-26-15-7-14-23(32(26)30-27)25-19-33-18-24(34-25)21-11-4-3-5-12-21/h3-4,6-11,13-15,17,24-25H,5,12,16,18-19H2,1-2H3,(H,28,30) |
| InChIKey | MIYJCSDURNXJBQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |