C21H23ClN2O4 — CID 68709463
5-[2-chloro-5-(methoxymethoxy)-4-(phenoxymethyl)phenoxy]-1,3,4-trimethylpyrazole (PubChem CID 68709463) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 5-[2-chloro-5-(methoxymethoxy)-4-(phenoxymethyl)phenoxy]-1,3,4-trimethylpyrazole.
| Compound Name | 5-[2-chloro-5-(methoxymethoxy)-4-(phenoxymethyl)phenoxy]-1,3,4-trimethylpyrazole |
|---|---|
| PubChem CID | 68709463 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 5-[2-chloro-5-(methoxymethoxy)-4-(phenoxymethyl)phenoxy]-1,3,4-trimethylpyrazole |
| SMILES | COCOc1cc(Oc2c(C)c(C)nn2C)c(Cl)cc1COc1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-14-15(2)23-24(3)21(14)28-20-11-19(27-13-25-4)16(10-18(20)22)12-26-17-8-6-5-7-9-17/h5-11H,12-13H2,1-4H3 |
| InChIKey | QPZXBTLZLBNOSZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|