C23H21N6OS+ — CID 68710368
[4-[4-amino-3-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 68710368) has the molecular formula C23H21N6OS+ and a molecular weight of 429.53 g/mol. Its IUPAC name is [4-[4-amino-3-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-[4-amino-3-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 68710368 |
| Molecular Formula | C23H21N6OS+ |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [4-[4-amino-3-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | N[N+]12C=CN=CC1=C(C1CCN(C(=O)c3ccsc3)CC1)N=C2C#Cc1cccnc1 |
| InChI | InChI=1S/C23H21N6OS/c24-29-12-9-26-15-20(29)22(27-21(29)4-3-17-2-1-8-25-14-17)18-5-10-28(11-6-18)23(30)19-7-13-31-16-19/h1-2,7-9,12-16,18H,5-6,10-11,24H2/q+1 |
| InChIKey | XBHPWSLLXPOESD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|