C11H12BrN5O2 — CID 71222653
3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate (PubChem CID 71222653) has the molecular formula C11H12BrN5O2 and a molecular weight of 326.15 g/mol. Its IUPAC name is 3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | 3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71222653 |
| Molecular Formula | C11H12BrN5O2 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate |
| SMILES | N[N+]12C=CN=CC1=C(C1CCN(C(=O)[O-])C1)N=C2Br |
| InChI | InChI=1S/C11H12BrN5O2/c12-10-15-9(7-1-3-16(6-7)11(18)19)8-5-14-2-4-17(8,10)13/h2,4-5,7H,1,3,6,13H2 |
| InChIKey | HOFOBKRPBCEBMA-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|