C13H15BrN5O2+ — CID 90283763
3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one (PubChem CID 90283763) has the molecular formula C13H15BrN5O2+ and a molecular weight of 353.20 g/mol. Its IUPAC name is 3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one.
| Compound Name | 3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one |
|---|---|
| PubChem CID | 90283763 |
| Molecular Formula | C13H15BrN5O2+ |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-(4-amino-3-bromoimidazo[1,5-a]pyrazin-4-ium-1-yl)-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one |
| SMILES | N[N+]12C=CN=CC1=C(C1CN3C(=O)CCC3CO1)N=C2Br |
| InChI | InChI=1S/C13H15BrN5O2/c14-13-17-12(9-5-16-3-4-19(9,13)15)10-6-18-8(7-21-10)1-2-11(18)20/h3-5,8,10H,1-2,6-7,15H2/q+1 |
| InChIKey | BSKZKLLJNCZPJF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|