C9H11N7O2 — CID 67393988
4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylate (PubChem CID 67393988) has the molecular formula C9H11N7O2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylate.
| Compound Name | 4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67393988 |
| Molecular Formula | C9H11N7O2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylate |
| SMILES | O=C([O-])N1CCN([N+]23C=CN=CC2=NN=N3)CC1 |
| InChI | InChI=1S/C9H11N7O2/c17-9(18)14-2-4-15(5-3-14)16-6-1-10-7-8(16)11-12-13-16/h1,6-7H,2-5H2 |
| InChIKey | YSERIFBAQNULEE-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 96.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|