C13H16N4O2 — CID 71225902
2-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperidine-1-carboxylate (PubChem CID 71225902) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperidine-1-carboxylate.
| Compound Name | 2-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71225902 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperidine-1-carboxylate |
| SMILES | C[N+]12C=CN=CC1=C(C1CCCCN1C(=O)[O-])N=C2 |
| InChI | InChI=1S/C13H16N4O2/c1-17-7-5-14-8-11(17)12(15-9-17)10-4-2-3-6-16(10)13(18)19/h5,7-10H,2-4,6H2,1H3 |
| InChIKey | NYYFUGBGJRERGJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|