C9H12N7O2+ — CID 67393989
4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylic acid (PubChem CID 67393989) has the molecular formula C9H12N7O2+ and a molecular weight of 250.24 g/mol. Its IUPAC name is 4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylic acid.
| Compound Name | 4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67393989 |
| Molecular Formula | C9H12N7O2+ |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-(tetrazolo[1,5-a]pyrazin-4-ium-4-yl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN([N+]23C=CN=CC2=NN=N3)CC1 |
| InChI | InChI=1S/C9H11N7O2/c17-9(18)14-2-4-15(5-3-14)16-6-1-10-7-8(16)11-12-13-16/h1,6-7H,2-5H2/p+1 |
| InChIKey | YSERIFBAQNULEE-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|