C14H21BrN5O2+ — CID 71074953
1-[4-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone;methanol (PubChem CID 71074953) has the molecular formula C14H21BrN5O2+ and a molecular weight of 371.26 g/mol. Its IUPAC name is 1-[4-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone;methanol.
| Compound Name | 1-[4-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone;methanol |
|---|---|
| PubChem CID | 71074953 |
| Molecular Formula | C14H21BrN5O2+ |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[4-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone;methanol |
| SMILES | CC(=O)N1CCN(C2=C3C=NC=C[N+]3(C)C(Br)=N2)CC1.CO |
| InChI | InChI=1S/C13H17BrN5O.CH4O/c1-10(20)17-4-6-18(7-5-17)12-11-9-15-3-8-19(11,2)13(14)16-12;1-2/h3,8-9H,4-7H2,1-2H3;2H,1H3/q+1; |
| InChIKey | NVBQEZQHYFBJNB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|