C16H22IN6O+ — CID 66676532
1-[4-[3-(4-amino-3-iodoimidazo[1,5-a]pyrazin-4-ium-1-yl)cyclobutyl]piperazin-1-yl]ethanone (PubChem CID 66676532) has the molecular formula C16H22IN6O+ and a molecular weight of 441.30 g/mol. Its IUPAC name is 1-[4-[3-(4-amino-3-iodoimidazo[1,5-a]pyrazin-4-ium-1-yl)cyclobutyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(4-amino-3-iodoimidazo[1,5-a]pyrazin-4-ium-1-yl)cyclobutyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 66676532 |
| Molecular Formula | C16H22IN6O+ |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 1-[4-[3-(4-amino-3-iodoimidazo[1,5-a]pyrazin-4-ium-1-yl)cyclobutyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C2CC(C3=C4C=NC=C[N+]4(N)C(I)=N3)C2)CC1 |
| InChI | InChI=1S/C16H22IN6O/c1-11(24)21-3-5-22(6-4-21)13-8-12(9-13)15-14-10-19-2-7-23(14,18)16(17)20-15/h2,7,10,12-13H,3-6,8-9,18H2,1H3/q+1 |
| InChIKey | JVCMLFHAJPACKS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 74.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|