C16H21IN6O — CID 90751764
1-[4-[3-(8-amino-6-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazin-1-yl]ethanone (PubChem CID 90751764) has the molecular formula C16H21IN6O and a molecular weight of 440.29 g/mol. Its IUPAC name is 1-[4-[3-(8-amino-6-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(8-amino-6-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90751764 |
| Molecular Formula | C16H21IN6O |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-[4-[3-(8-amino-6-iodoimidazo[1,5-a]pyrazin-3-yl)cyclobutyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C2CC(c3ncc4c(N)nc(I)cn34)C2)CC1 |
| InChI | InChI=1S/C16H21IN6O/c1-10(24)21-2-4-22(5-3-21)12-6-11(7-12)16-19-8-13-15(18)20-14(17)9-23(13)16/h8-9,11-12H,2-7H2,1H3,(H2,18,20) |
| InChIKey | JNOPHCHOMDFXFS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|