C12H14N4O2 — CID 67364195
3-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate (PubChem CID 67364195) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | 3-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67364195 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidine-1-carboxylate |
| SMILES | C[N+]12C=CN=CC1=C(C1CCN(C(=O)[O-])C1)N=C2 |
| InChI | InChI=1S/C12H14N4O2/c1-16-5-3-13-6-10(16)11(14-8-16)9-2-4-15(7-9)12(17)18/h3,5-6,8-9H,2,4,7H2,1H3 |
| InChIKey | NSNXITRMQNYSGP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|