C13H18N5O+ — CID 67363171
1-[4-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone (PubChem CID 67363171) has the molecular formula C13H18N5O+ and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-[4-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 67363171 |
| Molecular Formula | C13H18N5O+ |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[4-(4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C2=C3C=NC=C[N+]3(C)C=N2)CC1 |
| InChI | InChI=1S/C13H18N5O/c1-11(19)16-4-6-17(7-5-16)13-12-9-14-3-8-18(12,2)10-15-13/h3,8-10H,4-7H2,1-2H3/q+1 |
| InChIKey | PYTXPHNAPBVLLD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|