C11H16N5+ — CID 67364893
4-methyl-1-piperazin-1-ylimidazo[1,5-a]pyrazin-4-ium (PubChem CID 67364893) has the molecular formula C11H16N5+ and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-methyl-1-piperazin-1-ylimidazo[1,5-a]pyrazin-4-ium.
| Compound Name | 4-methyl-1-piperazin-1-ylimidazo[1,5-a]pyrazin-4-ium |
|---|---|
| PubChem CID | 67364893 |
| Molecular Formula | C11H16N5+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-methyl-1-piperazin-1-ylimidazo[1,5-a]pyrazin-4-ium |
| SMILES | C[N+]12C=CN=CC1=C(N1CCNCC1)N=C2 |
| InChI | InChI=1S/C11H16N5/c1-16-7-4-13-8-10(16)11(14-9-16)15-5-2-12-3-6-15/h4,7-9,12H,2-3,5-6H2,1H3/q+1 |
| InChIKey | HXRGGOAUHMNKHK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|