C14H18BrN4O2+ — CID 67362735
1-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-2-methoxyethanone (PubChem CID 67362735) has the molecular formula C14H18BrN4O2+ and a molecular weight of 354.23 g/mol. Its IUPAC name is 1-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 67362735 |
| Molecular Formula | C14H18BrN4O2+ |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-[3-(3-bromo-4-methylimidazo[1,5-a]pyrazin-4-ium-1-yl)pyrrolidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(C2=C3C=NC=C[N+]3(C)C(Br)=N2)C1 |
| InChI | InChI=1S/C14H18BrN4O2/c1-19-6-4-16-7-11(19)13(17-14(19)15)10-3-5-18(8-10)12(20)9-21-2/h4,6-7,10H,3,5,8-9H2,1-2H3/q+1 |
| InChIKey | JYWVFBMIRQLTNS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|