C13H8ClF2N3O2 — CID 68715711
N'-(4-chlorobenzoyl)-2,6-difluoropyridine-3-carbohydrazide (PubChem CID 68715711) has the molecular formula C13H8ClF2N3O2 and a molecular weight of 311.68 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-2,6-difluoropyridine-3-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-2,6-difluoropyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 68715711 |
| Molecular Formula | C13H8ClF2N3O2 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N'-(4-chlorobenzoyl)-2,6-difluoropyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(F)nc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H8ClF2N3O2/c14-8-3-1-7(2-4-8)12(20)18-19-13(21)9-5-6-10(15)17-11(9)16/h1-6H,(H,18,20)(H,19,21) |
| InChIKey | QJKZHJTUBATINK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|