C12H6ClF4N3O — CID 2604242
6-chloro-N'-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbohydrazide (PubChem CID 2604242) has the molecular formula C12H6ClF4N3O and a molecular weight of 319.65 g/mol. Its IUPAC name is 6-chloro-N'-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbohydrazide.
| Compound Name | 6-chloro-N'-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 2604242 |
| Molecular Formula | C12H6ClF4N3O |
| Molecular Weight | 319.65 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 6-chloro-N'-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1c(F)c(F)cc(F)c1F)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H6ClF4N3O/c13-8-2-1-5(4-18-8)12(21)20-19-11-9(16)6(14)3-7(15)10(11)17/h1-4,19H,(H,20,21) |
| InChIKey | XZMLWIAYVCHIHQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.65 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|