C17H14ClF4N3O2 — CID 141400826
N-tert-butyl-6-chloro-N'-(2,3,5,6-tetrafluorobenzoyl)pyridine-3-carbohydrazide (PubChem CID 141400826) has the molecular formula C17H14ClF4N3O2 and a molecular weight of 403.76 g/mol. Its IUPAC name is N-tert-butyl-6-chloro-N'-(2,3,5,6-tetrafluorobenzoyl)pyridine-3-carbohydrazide.
| Compound Name | N-tert-butyl-6-chloro-N'-(2,3,5,6-tetrafluorobenzoyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 141400826 |
| Molecular Formula | C17H14ClF4N3O2 |
| Molecular Weight | 403.76 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-tert-butyl-6-chloro-N'-(2,3,5,6-tetrafluorobenzoyl)pyridine-3-carbohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1c(F)c(F)cc(F)c1F)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H14ClF4N3O2/c1-17(2,3)25(16(27)8-4-5-11(18)23-7-8)24-15(26)12-13(21)9(19)6-10(20)14(12)22/h4-7H,1-3H3,(H,24,26) |
| InChIKey | KDGBMYSOBNESPR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|