C17H17ClFN3O2 — CID 141400759
N-tert-butyl-6-chloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide (PubChem CID 141400759) has the molecular formula C17H17ClFN3O2 and a molecular weight of 349.79 g/mol. Its IUPAC name is N-tert-butyl-6-chloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide.
| Compound Name | N-tert-butyl-6-chloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 141400759 |
| Molecular Formula | C17H17ClFN3O2 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-tert-butyl-6-chloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccccc1F)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H17ClFN3O2/c1-17(2,3)22(16(24)11-8-9-14(18)20-10-11)21-15(23)12-6-4-5-7-13(12)19/h4-10H,1-3H3,(H,21,23) |
| InChIKey | UBTHNQNNAQQJQC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|