C18H17NO3S — CID 68716584
4-ethenyl-1-(2-methoxy-5-methylphenyl)sulfonylindole (PubChem CID 68716584) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-ethenyl-1-(2-methoxy-5-methylphenyl)sulfonylindole.
| Compound Name | 4-ethenyl-1-(2-methoxy-5-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 68716584 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-ethenyl-1-(2-methoxy-5-methylphenyl)sulfonylindole |
| SMILES | C=Cc1cccc2c1ccn2S(=O)(=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C18H17NO3S/c1-4-14-6-5-7-16-15(14)10-11-19(16)23(20,21)18-12-13(2)8-9-17(18)22-3/h4-12H,1H2,2-3H3 |
| InChIKey | BLSMSRFDOCLYNS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |