C21H20F4N2O5S — CID 68716764
1-[[1-(benzenesulfonyl)-6-fluoro-5-methoxyindol-4-yl]methyl-methylamino]ethyl 2,2,2-trifluoroacetate (PubChem CID 68716764) has the molecular formula C21H20F4N2O5S and a molecular weight of 488.46 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)-6-fluoro-5-methoxyindol-4-yl]methyl-methylamino]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 1-[[1-(benzenesulfonyl)-6-fluoro-5-methoxyindol-4-yl]methyl-methylamino]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68716764 |
| Molecular Formula | C21H20F4N2O5S |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)-6-fluoro-5-methoxyindol-4-yl]methyl-methylamino]ethyl 2,2,2-trifluoroacetate |
| SMILES | COc1c(F)cc2c(ccn2S(=O)(=O)c2ccccc2)c1CN(C)C(C)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H20F4N2O5S/c1-13(32-20(28)21(23,24)25)26(2)12-16-15-9-10-27(18(15)11-17(22)19(16)31-3)33(29,30)14-7-5-4-6-8-14/h4-11,13H,12H2,1-3H3 |
| InChIKey | LVLHXKMVSCRLIY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|