C21H18F6N2O5S — CID 140523184
[1-hydroxy-2-[1-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]ethylamino]ethyl] 2,2,2-trifluoroacetate (PubChem CID 140523184) has the molecular formula C21H18F6N2O5S and a molecular weight of 524.44 g/mol. Its IUPAC name is [1-hydroxy-2-[1-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]ethylamino]ethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-hydroxy-2-[1-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]ethylamino]ethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140523184 |
| Molecular Formula | C21H18F6N2O5S |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | [1-hydroxy-2-[1-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]ethylamino]ethyl] 2,2,2-trifluoroacetate |
| SMILES | CC(NCC(O)OC(=O)C(F)(F)F)c1cccc2c1ccn2S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6N2O5S/c1-12(28-11-18(30)34-19(31)21(25,26)27)15-6-3-7-17-16(15)8-9-29(17)35(32,33)14-5-2-4-13(10-14)20(22,23)24/h2-10,12,18,28,30H,11H2,1H3 |
| InChIKey | MELVQDCCMMQISA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|