About 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane
3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane (PubChem CID 68717270) has the molecular formula C19H21N3O3
and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane |
| PubChem CID | 68717270 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane |
| SMILES | CC1C(Oc2nnccc2-c2ccc3c(c2)OCO3)C2CCN1CC2 |
| InChI | InChI=1S/C19H21N3O3/c1-12-18(13-5-8-22(12)9-6-13)25-19-15(4-7-20-21-19)14-2-3-16-17(10-14)24-11-23-16/h2-4,7,10,12-13,18H,5-6,8-9,11H2,1H3 |
| InChIKey | GGUNEJFOVIZSQZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane?
The IUPAC name of 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane (CID 68717270) is 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane.
What is the SMILES notation for 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane?
The canonical SMILES for 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane is CC1C(Oc2nnccc2-c2ccc3c(c2)OCO3)C2CCN1CC2.
What is the InChIKey of 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane?
The InChIKey is GGUNEJFOVIZSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3/c1-12-18(13-5-8-22(12)9-6-13)25-19-15(4-7-20-21-19)14-2-3-16-17(10-14)24-11-23-16/h2-4,7,10,12-13,18H,5-6,8-9,11H2,1H3.
What are the key properties of 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane?
3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane has a molecular weight of 339.40 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,3-benzodioxol-5-yl)pyridazin-3-yl]oxy-2-methyl-1-azabicyclo[2.2.2]octane is sourced from PubChem (CID 68717270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).