C21H20F3NO2 — CID 68719665
N-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide (PubChem CID 68719665) has the molecular formula C21H20F3NO2 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide.
| Compound Name | N-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
|---|---|
| PubChem CID | 68719665 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
| SMILES | Cc1cc(C=CC(F)(F)F)ccc1C(=O)Nc1cccc2c1CC(O)CC2 |
| InChI | InChI=1S/C21H20F3NO2/c1-13-11-14(9-10-21(22,23)24)5-8-17(13)20(27)25-19-4-2-3-15-6-7-16(26)12-18(15)19/h2-5,8-11,16,26H,6-7,12H2,1H3,(H,25,27) |
| InChIKey | DHUYODWUKHLCNS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |