C17H20O4 — CID 68720523
2-[2-hydroxy-5-(2-methoxyphenyl)-2-bicyclo[2.2.2]oct-5-enyl]acetic acid (PubChem CID 68720523) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-[2-hydroxy-5-(2-methoxyphenyl)-2-bicyclo[2.2.2]oct-5-enyl]acetic acid.
| Compound Name | 2-[2-hydroxy-5-(2-methoxyphenyl)-2-bicyclo[2.2.2]oct-5-enyl]acetic acid |
|---|---|
| PubChem CID | 68720523 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[2-hydroxy-5-(2-methoxyphenyl)-2-bicyclo[2.2.2]oct-5-enyl]acetic acid |
| SMILES | COc1ccccc1C1=CC2CCC1CC2(O)CC(=O)O |
| InChI | InChI=1S/C17H20O4/c1-21-15-5-3-2-4-13(15)14-8-12-7-6-11(14)9-17(12,20)10-16(18)19/h2-5,8,11-12,20H,6-7,9-10H2,1H3,(H,18,19) |
| InChIKey | KRZQFGFPSJWFQI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |