C19H20F3N5O2S — CID 68726022
N-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)-4-[[3-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide (PubChem CID 68726022) has the molecular formula C19H20F3N5O2S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)-4-[[3-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)-4-[[3-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 68726022 |
| Molecular Formula | C19H20F3N5O2S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)-4-[[3-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide |
| SMILES | O=C(NC1=CC=CN2SNC=C12)N1CCN(Cc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H20F3N5O2S/c20-19(21,22)29-15-4-1-3-14(11-15)13-25-7-9-26(10-8-25)18(28)24-16-5-2-6-27-17(16)12-23-30-27/h1-6,11-12,23H,7-10,13H2,(H,24,28) |
| InChIKey | PSULCKXAWMDSIE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|