C10H11F2NO3 — CID 68726221
[1-(2,3-difluorophenyl)-1-methoxyethyl]carbamic acid (PubChem CID 68726221) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is [1-(2,3-difluorophenyl)-1-methoxyethyl]carbamic acid.
| Compound Name | [1-(2,3-difluorophenyl)-1-methoxyethyl]carbamic acid |
|---|---|
| PubChem CID | 68726221 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | [1-(2,3-difluorophenyl)-1-methoxyethyl]carbamic acid |
| SMILES | COC(C)(NC(=O)O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H11F2NO3/c1-10(16-2,13-9(14)15)6-4-3-5-7(11)8(6)12/h3-5,13H,1-2H3,(H,14,15) |
| InChIKey | DLMIDFFNHSPATB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|