C21H20ClF4N3O4 — CID 68730490
methyl 3-chloro-4-[1-[ethyl-[[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]carbamoyl]amino]ethyl]benzoate (PubChem CID 68730490) has the molecular formula C21H20ClF4N3O4 and a molecular weight of 489.85 g/mol. Its IUPAC name is methyl 3-chloro-4-[1-[ethyl-[[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]carbamoyl]amino]ethyl]benzoate.
| Compound Name | methyl 3-chloro-4-[1-[ethyl-[[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]carbamoyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 68730490 |
| Molecular Formula | C21H20ClF4N3O4 |
| Molecular Weight | 489.85 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | methyl 3-chloro-4-[1-[ethyl-[[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]carbamoyl]amino]ethyl]benzoate |
| SMILES | CCN(C(=O)NNC(=O)c1cc(F)cc(C(F)(F)F)c1)C(C)c1ccc(C(=O)OC)cc1Cl |
| InChI | InChI=1S/C21H20ClF4N3O4/c1-4-29(11(2)16-6-5-12(9-17(16)22)19(31)33-3)20(32)28-27-18(30)13-7-14(21(24,25)26)10-15(23)8-13/h5-11H,4H2,1-3H3,(H,27,30)(H,28,32) |
| InChIKey | PJMOZXZTWUYPFS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|