C29H36N2O3S — CID 68737457
3-(4-morpholin-4-ylsulfonylphenyl)-N-(2-naphthalen-1-ylethyl)cycloheptan-1-amine (PubChem CID 68737457) has the molecular formula C29H36N2O3S and a molecular weight of 492.69 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-N-(2-naphthalen-1-ylethyl)cycloheptan-1-amine.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-(2-naphthalen-1-ylethyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 68737457 |
| Molecular Formula | C29H36N2O3S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-(2-naphthalen-1-ylethyl)cycloheptan-1-amine |
| SMILES | O=S(=O)(c1ccc(C2CCCCC(NCCc3cccc4ccccc34)C2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C29H36N2O3S/c32-35(33,31-18-20-34-21-19-31)28-14-12-23(13-15-28)26-7-1-3-10-27(22-26)30-17-16-25-9-5-8-24-6-2-4-11-29(24)25/h2,4-6,8-9,11-15,26-27,30H,1,3,7,10,16-22H2 |
| InChIKey | NMXGCBIQUQFZAB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |