C29H35N3 — CID 68738369
N-(2-naphthalen-1-ylethyl)-3-[4-(pyrrolidine-1-carboximidoyl)phenyl]cyclohexan-1-amine (PubChem CID 68738369) has the molecular formula C29H35N3 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-(2-naphthalen-1-ylethyl)-3-[4-(pyrrolidine-1-carboximidoyl)phenyl]cyclohexan-1-amine.
| Compound Name | N-(2-naphthalen-1-ylethyl)-3-[4-(pyrrolidine-1-carboximidoyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 68738369 |
| Molecular Formula | C29H35N3 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | N-(2-naphthalen-1-ylethyl)-3-[4-(pyrrolidine-1-carboximidoyl)phenyl]cyclohexan-1-amine |
| SMILES | [H]/N=C(/c1ccc(C2CCCC(NCCc3cccc4ccccc34)C2)cc1)N1CCCC1 |
| InChI | InChI=1S/C29H35N3/c30-29(32-19-3-4-20-32)25-15-13-22(14-16-25)26-10-6-11-27(21-26)31-18-17-24-9-5-8-23-7-1-2-12-28(23)24/h1-2,5,7-9,12-16,26-27,30-31H,3-4,6,10-11,17-21H2/b30-29- |
| InChIKey | PEGCDTGNTIYCLY-FLWNBWAVSA-N |
| XLogP | 6.12 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|