C10H16N4O5 — CID 68738224
benzene-1,3-diol;2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide (PubChem CID 68738224) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is benzene-1,3-diol;2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide.
| Compound Name | benzene-1,3-diol;2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide |
|---|---|
| PubChem CID | 68738224 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | benzene-1,3-diol;2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide |
| SMILES | NNC(=O)COCC(=O)NN.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.C4H10N4O3/c7-5-2-1-3-6(8)4-5;5-7-3(9)1-11-2-4(10)8-6/h1-4,7-8H;1-2,5-6H2,(H,7,9)(H,8,10) |
| InChIKey | GXGMLHLXTNVBOQ-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|