C18H24N4O5 — CID 68738715
2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide;4-[1-(4-hydroxyphenyl)ethyl]phenol (PubChem CID 68738715) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide;4-[1-(4-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide;4-[1-(4-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 68738715 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-(2-hydrazinyl-2-oxoethoxy)acetohydrazide;4-[1-(4-hydroxyphenyl)ethyl]phenol |
| SMILES | CC(c1ccc(O)cc1)c1ccc(O)cc1.NNC(=O)COCC(=O)NN |
| InChI | InChI=1S/C14H14O2.C4H10N4O3/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12;5-7-3(9)1-11-2-4(10)8-6/h2-10,15-16H,1H3;1-2,5-6H2,(H,7,9)(H,8,10) |
| InChIKey | UYINXWLEUKYMEC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|