C20H22O8S — CID 68739070
1-(4-methoxyphenyl)-3-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxythiophen-2-yl]prop-2-en-1-one (PubChem CID 68739070) has the molecular formula C20H22O8S and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxythiophen-2-yl]prop-2-en-1-one.
| Compound Name | 1-(4-methoxyphenyl)-3-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxythiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68739070 |
| Molecular Formula | C20H22O8S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxythiophen-2-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2sccc2OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C20H22O8S/c1-26-12-4-2-11(3-5-12)13(22)6-7-16-14(8-9-29-16)27-20-19(25)18(24)17(23)15(10-21)28-20/h2-9,15,17-21,23-25H,10H2,1H3 |
| InChIKey | HNEWLYNXNLWCFB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|