C19H25F2NO2S — CID 68739968
(5R)-5-(2,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-1-(4-methylsulfanylbutyl)pyrrolidin-2-one (PubChem CID 68739968) has the molecular formula C19H25F2NO2S and a molecular weight of 369.48 g/mol. Its IUPAC name is (5R)-5-(2,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-1-(4-methylsulfanylbutyl)pyrrolidin-2-one.
| Compound Name | (5R)-5-(2,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-1-(4-methylsulfanylbutyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 68739968 |
| Molecular Formula | C19H25F2NO2S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (5R)-5-(2,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-1-(4-methylsulfanylbutyl)pyrrolidin-2-one |
| SMILES | CSCCCCN1C(=O)CC[C@@H]1C=C(F)C(O)C(F)c1ccccc1 |
| InChI | InChI=1S/C19H25F2NO2S/c1-25-12-6-5-11-22-15(9-10-17(22)23)13-16(20)19(24)18(21)14-7-3-2-4-8-14/h2-4,7-8,13,15,18-19,24H,5-6,9-12H2,1H3/t15-,18?,19?/m1/s1 |
| InChIKey | ZLVPOHFUYJBFCK-VNCLNFNDSA-N |
| XLogP | 4.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|