C28H31N3O — CID 68744413
3-(2-aminophenyl)-1-[5-(3,5-dimethylphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one (PubChem CID 68744413) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[5-(3,5-dimethylphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 3-(2-aminophenyl)-1-[5-(3,5-dimethylphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68744413 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 3-(2-aminophenyl)-1-[5-(3,5-dimethylphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
| SMILES | Cc1cc(C)cc(-c2ccc(N3CCN(C)CC3)c(C(=O)C=Cc3ccccc3N)c2)c1 |
| InChI | InChI=1S/C28H31N3O/c1-20-16-21(2)18-24(17-20)23-8-10-27(31-14-12-30(3)13-15-31)25(19-23)28(32)11-9-22-6-4-5-7-26(22)29/h4-11,16-19H,12-15,29H2,1-3H3 |
| InChIKey | NGUIKJWUEWABSG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|