C28H29FN2O3 — CID 68744445
1-(2-fluoro-4-methoxyphenyl)-3-[5-[3-(hydroxymethyl)phenyl]-2-(1-methylpiperazin-2-yl)phenyl]prop-2-en-1-one (PubChem CID 68744445) has the molecular formula C28H29FN2O3 and a molecular weight of 460.55 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-3-[5-[3-(hydroxymethyl)phenyl]-2-(1-methylpiperazin-2-yl)phenyl]prop-2-en-1-one.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-3-[5-[3-(hydroxymethyl)phenyl]-2-(1-methylpiperazin-2-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68744445 |
| Molecular Formula | C28H29FN2O3 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-3-[5-[3-(hydroxymethyl)phenyl]-2-(1-methylpiperazin-2-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cc(-c3cccc(CO)c3)ccc2C2CNCCN2C)c(F)c1 |
| InChI | InChI=1S/C28H29FN2O3/c1-31-13-12-30-17-27(31)24-9-6-21(20-5-3-4-19(14-20)18-32)15-22(24)7-11-28(33)25-10-8-23(34-2)16-26(25)29/h3-11,14-16,27,30,32H,12-13,17-18H2,1-2H3 |
| InChIKey | DHDFBBWFWAJFDY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|