About (4-oxocyclohexyl) carbamate
(4-oxocyclohexyl) carbamate (PubChem CID 68755566) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is (4-oxocyclohexyl) carbamate.
Molecular Properties
| Compound Name | (4-oxocyclohexyl) carbamate |
| PubChem CID | 68755566 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (4-oxocyclohexyl) carbamate |
| SMILES | NC(=O)OC1CCC(=O)CC1 |
| InChI | InChI=1S/C7H11NO3/c8-7(10)11-6-3-1-5(9)2-4-6/h6H,1-4H2,(H2,8,10) |
| InChIKey | COWFSVXNQHIZDB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-oxocyclohexyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxocyclohexyl) carbamate?
The IUPAC name of (4-oxocyclohexyl) carbamate (CID 68755566) is (4-oxocyclohexyl) carbamate.
What is the SMILES notation for (4-oxocyclohexyl) carbamate?
The canonical SMILES for (4-oxocyclohexyl) carbamate is NC(=O)OC1CCC(=O)CC1.
What is the InChIKey of (4-oxocyclohexyl) carbamate?
The InChIKey is COWFSVXNQHIZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c8-7(10)11-6-3-1-5(9)2-4-6/h6H,1-4H2,(H2,8,10).
What are the key properties of (4-oxocyclohexyl) carbamate?
(4-oxocyclohexyl) carbamate has a molecular weight of 157.17 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxocyclohexyl) carbamate is sourced from PubChem (CID 68755566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).