C19H18N6O5 — CID 68756154
[3-[(8-carbamoylquinazolin-4-yl)amino]-3-(3-nitrophenyl)propyl]carbamic acid (PubChem CID 68756154) has the molecular formula C19H18N6O5 and a molecular weight of 410.39 g/mol. Its IUPAC name is [3-[(8-carbamoylquinazolin-4-yl)amino]-3-(3-nitrophenyl)propyl]carbamic acid.
| Compound Name | [3-[(8-carbamoylquinazolin-4-yl)amino]-3-(3-nitrophenyl)propyl]carbamic acid |
|---|---|
| PubChem CID | 68756154 |
| Molecular Formula | C19H18N6O5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [3-[(8-carbamoylquinazolin-4-yl)amino]-3-(3-nitrophenyl)propyl]carbamic acid |
| SMILES | NC(=O)c1cccc2c(NC(CCNC(=O)O)c3cccc([N+](=O)[O-])c3)ncnc12 |
| InChI | InChI=1S/C19H18N6O5/c20-17(26)13-5-2-6-14-16(13)22-10-23-18(14)24-15(7-8-21-19(27)28)11-3-1-4-12(9-11)25(29)30/h1-6,9-10,15,21H,7-8H2,(H2,20,26)(H,27,28)(H,22,23,24) |
| InChIKey | QVIHOMGTYQPPEC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 173.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|