C25H29N7O3 — CID 89044080
4-[[1-[3-[(2-amino-4-cyclopropyl-4-iminobutanoyl)amino]phenyl]-3-hydroxypropyl]amino]quinazoline-8-carboxamide (PubChem CID 89044080) has the molecular formula C25H29N7O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-[[1-[3-[(2-amino-4-cyclopropyl-4-iminobutanoyl)amino]phenyl]-3-hydroxypropyl]amino]quinazoline-8-carboxamide.
| Compound Name | 4-[[1-[3-[(2-amino-4-cyclopropyl-4-iminobutanoyl)amino]phenyl]-3-hydroxypropyl]amino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 89044080 |
| Molecular Formula | C25H29N7O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 4-[[1-[3-[(2-amino-4-cyclopropyl-4-iminobutanoyl)amino]phenyl]-3-hydroxypropyl]amino]quinazoline-8-carboxamide |
| SMILES | [H]/N=C(/CC(N)C(=O)Nc1cccc(C(CCO)Nc2ncnc3c(C(N)=O)cccc23)c1)C1CC1 |
| InChI | InChI=1S/C25H29N7O3/c26-19(14-7-8-14)12-20(27)25(35)31-16-4-1-3-15(11-16)21(9-10-33)32-24-18-6-2-5-17(23(28)34)22(18)29-13-30-24/h1-6,11,13-14,20-21,26,33H,7-10,12,27H2,(H2,28,34)(H,31,35)(H,29,30,32)/b26-19- |
| InChIKey | SVCGYJCVSXQWIZ-XHPQRKPJSA-N |
| XLogP | 2.35 |
| TPSA | 180.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|